About N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione
N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione (PubChem CID 86598967) has the molecular formula C7H11IN2O3
and a molecular weight of 298.08 g/mol. Its IUPAC name is N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione |
| PubChem CID | 86598967 |
| Molecular Formula | C7H11IN2O3 |
| Molecular Weight | 298.08 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione |
| SMILES | CN(C)C=O.O=C1CCC(=O)N1I |
| InChI | InChI=1S/C4H4INO2.C3H7NO/c5-6-3(7)1-2-4(6)8;1-4(2)3-5/h1-2H2;3H,1-2H3 |
| InChIKey | UUVNLMYEDNTCGZ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.08 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione?
The IUPAC name of N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione (CID 86598967) is N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione.
What is the SMILES notation for N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione?
The canonical SMILES for N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione is CN(C)C=O.O=C1CCC(=O)N1I.
What is the InChIKey of N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione?
The InChIKey is UUVNLMYEDNTCGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4INO2.C3H7NO/c5-6-3(7)1-2-4(6)8;1-4(2)3-5/h1-2H2;3H,1-2H3.
What are the key properties of N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione?
N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione has a molecular weight of 298.08 g/mol, XLogP of 0.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;1-iodopyrrolidine-2,5-dione is sourced from PubChem (CID 86598967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).