C24H18F6O4S — CID 86599078
[7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86599078) has the molecular formula C24H18F6O4S and a molecular weight of 516.46 g/mol. Its IUPAC name is [7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86599078 |
| Molecular Formula | C24H18F6O4S |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | [7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro-1-benzofuran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2Cc3cccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c3O2)cc1 |
| InChI | InChI=1S/C24H18F6O4S/c1-14-5-7-20(8-6-14)35(31,32)33-13-19-11-15-3-2-4-21(22(15)34-19)16-9-17(23(25,26)27)12-18(10-16)24(28,29)30/h2-10,12,19H,11,13H2,1H3 |
| InChIKey | FASAAESSBOFVHN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|