About (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine
(2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine (PubChem CID 86599469) has the molecular formula C21H22F3NO3
and a molecular weight of 393.41 g/mol. Its IUPAC name is (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine.
Molecular Properties
| Compound Name | (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine |
| PubChem CID | 86599469 |
| Molecular Formula | C21H22F3NO3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine |
| SMILES | C[C@H](N)c1ccccc1.Cc1cc(C)c2c(c1)C=C(C(=O)O)[C@H](C(F)(F)F)O2 |
| InChI | InChI=1S/C13H11F3O3.C8H11N/c1-6-3-7(2)10-8(4-6)5-9(12(17)18)11(19-10)13(14,15)16;1-7(9)8-5-3-2-4-6-8/h3-5,11H,1-2H3,(H,17,18);2-7H,9H2,1H3/t11-;7-/m10/s1 |
| InChIKey | ZBZUUGUXAKFCCT-HGOAGKEZSA-N |
| XLogP | 4.80 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine?
The IUPAC name of (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine (CID 86599469) is (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine.
What is the SMILES notation for (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine?
The canonical SMILES for (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine is C[C@H](N)c1ccccc1.Cc1cc(C)c2c(c1)C=C(C(=O)O)[C@H](C(F)(F)F)O2.
What is the InChIKey of (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine?
The InChIKey is ZBZUUGUXAKFCCT-HGOAGKEZSA-N. The full InChI is InChI=1S/C13H11F3O3.C8H11N/c1-6-3-7(2)10-8(4-6)5-9(12(17)18)11(19-10)13(14,15)16;1-7(9)8-5-3-2-4-6-8/h3-5,11H,1-2H3,(H,17,18);2-7H,9H2,1H3/t11-;7-/m10/s1.
What are the key properties of (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine?
(2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine has a molecular weight of 393.41 g/mol, XLogP of 4.80, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;(1S)-1-phenylethanamine is sourced from PubChem (CID 86599469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).