C6H15N4O2P — CID 86599757
(3S)-1-diaminophosphoryl-3-(methylamino)piperidin-2-one (PubChem CID 86599757) has the molecular formula C6H15N4O2P and a molecular weight of 206.19 g/mol. Its IUPAC name is (3S)-1-diaminophosphoryl-3-(methylamino)piperidin-2-one.
| Compound Name | (3S)-1-diaminophosphoryl-3-(methylamino)piperidin-2-one |
|---|---|
| PubChem CID | 86599757 |
| Molecular Formula | C6H15N4O2P |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (3S)-1-diaminophosphoryl-3-(methylamino)piperidin-2-one |
| SMILES | CN[C@H]1CCCN(P(N)(N)=O)C1=O |
| InChI | InChI=1S/C6H15N4O2P/c1-9-5-3-2-4-10(6(5)11)13(7,8)12/h5,9H,2-4H2,1H3,(H4,7,8,12)/t5-/m0/s1 |
| InChIKey | BDQXVLSWQNTZOX-YFKPBYRVSA-N |
| XLogP | -0.78 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|