C17H24N4O5P+ — CID 86599773
[1-amino-2-oxo-3-(phenylmethoxycarbonylamino)piperidin-3-yl]-(butanoylamino)-oxophosphanium (PubChem CID 86599773) has the molecular formula C17H24N4O5P+ and a molecular weight of 395.38 g/mol. Its IUPAC name is [1-amino-2-oxo-3-(phenylmethoxycarbonylamino)piperidin-3-yl]-(butanoylamino)-oxophosphanium.
| Compound Name | [1-amino-2-oxo-3-(phenylmethoxycarbonylamino)piperidin-3-yl]-(butanoylamino)-oxophosphanium |
|---|---|
| PubChem CID | 86599773 |
| Molecular Formula | C17H24N4O5P+ |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [1-amino-2-oxo-3-(phenylmethoxycarbonylamino)piperidin-3-yl]-(butanoylamino)-oxophosphanium |
| SMILES | CCCC(=O)N[P+](=O)C1(NC(=O)OCc2ccccc2)CCCN(N)C1=O |
| InChI | InChI=1S/C17H23N4O5P/c1-2-7-14(22)20-27(25)17(10-6-11-21(18)15(17)23)19-16(24)26-12-13-8-4-3-5-9-13/h3-5,8-9H,2,6-7,10-12,18H2,1H3,(H-,19,20,22,24,25)/p+1 |
| InChIKey | NDHWXPDYDAKRIF-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|