C16H29BrO6P2 — CID 86600084
6-bromo-1,6-bis(diethoxyphosphoryl)-2,5-dimethylcyclohexa-1,3-diene (PubChem CID 86600084) has the molecular formula C16H29BrO6P2 and a molecular weight of 459.25 g/mol. Its IUPAC name is 6-bromo-1,6-bis(diethoxyphosphoryl)-2,5-dimethylcyclohexa-1,3-diene.
| Compound Name | 6-bromo-1,6-bis(diethoxyphosphoryl)-2,5-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 86600084 |
| Molecular Formula | C16H29BrO6P2 |
| Molecular Weight | 459.25 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 6-bromo-1,6-bis(diethoxyphosphoryl)-2,5-dimethylcyclohexa-1,3-diene |
| SMILES | CCOP(=O)(OCC)C1=C(C)C=CC(C)C1(Br)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H29BrO6P2/c1-7-20-24(18,21-8-2)15-13(5)11-12-14(6)16(15,17)25(19,22-9-3)23-10-4/h11-12,14H,7-10H2,1-6H3 |
| InChIKey | IFFKIOIRBZNCDH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.25 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|