C15H20F3NOS — CID 86600267
(2R)-3-cyclopropyl-2-methyl-1-sulfanyl-2-[(2,2,2-trifluoro-1-phenylethyl)amino]propan-1-ol (PubChem CID 86600267) has the molecular formula C15H20F3NOS and a molecular weight of 319.39 g/mol. Its IUPAC name is (2R)-3-cyclopropyl-2-methyl-1-sulfanyl-2-[(2,2,2-trifluoro-1-phenylethyl)amino]propan-1-ol.
| Compound Name | (2R)-3-cyclopropyl-2-methyl-1-sulfanyl-2-[(2,2,2-trifluoro-1-phenylethyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 86600267 |
| Molecular Formula | C15H20F3NOS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (2R)-3-cyclopropyl-2-methyl-1-sulfanyl-2-[(2,2,2-trifluoro-1-phenylethyl)amino]propan-1-ol |
| SMILES | C[C@](CC1CC1)(NC(c1ccccc1)C(F)(F)F)C(O)S |
| InChI | InChI=1S/C15H20F3NOS/c1-14(13(20)21,9-10-7-8-10)19-12(15(16,17)18)11-5-3-2-4-6-11/h2-6,10,12-13,19-21H,7-9H2,1H3/t12?,13?,14-/m1/s1 |
| InChIKey | IBZAWJDRRHKKAF-JXQTWKCFSA-N |
| XLogP | 3.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|