C21H22N4O4S — CID 86600936
tert-butyl (2S)-1-[6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinazolin-4-yl]pyrrolidine-2-carboxylate (PubChem CID 86600936) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is tert-butyl (2S)-1-[6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinazolin-4-yl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinazolin-4-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 86600936 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | tert-butyl (2S)-1-[6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]quinazolin-4-yl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1c1ncnc2ccc(C=C3SC(=O)NC3=O)cc12 |
| InChI | InChI=1S/C21H22N4O4S/c1-21(2,3)29-19(27)15-5-4-8-25(15)17-13-9-12(6-7-14(13)22-11-23-17)10-16-18(26)24-20(28)30-16/h6-7,9-11,15H,4-5,8H2,1-3H3,(H,24,26,28)/t15-/m0/s1 |
| InChIKey | VJUOELZTDZHOTR-HNNXBMFYSA-N |
| XLogP | 3.26 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|