About [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane
[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane (PubChem CID 86601250) has the molecular formula C24H35F6N3Sn
and a molecular weight of 598.26 g/mol. Its IUPAC name is [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane.
Molecular Properties
| Compound Name | [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane |
| PubChem CID | 86601250 |
| Molecular Formula | C24H35F6N3Sn |
| Molecular Weight | 598.26 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1nnn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C12H8F6N3.3C4H9.Sn/c1-7-5-19-20-21(7)6-8-2-9(11(13,14)15)4-10(3-8)12(16,17)18;3*1-3-4-2;/h2-4H,6H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | OZKLSMPVECFXQK-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 598.26 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane?
The IUPAC name of [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane (CID 86601250) is [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane.
What is the SMILES notation for [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane?
The canonical SMILES for [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane is CCCC[Sn](CCCC)(CCCC)c1nnn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1C.
What is the InChIKey of [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane?
The InChIKey is OZKLSMPVECFXQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F6N3.3C4H9.Sn/c1-7-5-19-20-21(7)6-8-2-9(11(13,14)15)4-10(3-8)12(16,17)18;3*1-3-4-2;/h2-4H,6H2,1H3;3*1,3-4H2,2H3;.
What are the key properties of [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane?
[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane has a molecular weight of 598.26 g/mol, XLogP of 7.73, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-methyltriazol-4-yl]-tributylstannane is sourced from PubChem (CID 86601250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).