C29H29ClN2O2 — CID 86601396
tert-butyl N-[(E,2S)-4-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenyl]pent-3-en-2-yl]carbamate (PubChem CID 86601396) has the molecular formula C29H29ClN2O2 and a molecular weight of 473.02 g/mol. Its IUPAC name is tert-butyl N-[(E,2S)-4-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenyl]pent-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S)-4-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenyl]pent-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 86601396 |
| Molecular Formula | C29H29ClN2O2 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | tert-butyl N-[(E,2S)-4-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenyl]pent-3-en-2-yl]carbamate |
| SMILES | C/C(=C\[C@H](C)NC(=O)OC(C)(C)C)c1ccc(C#Cc2ccc(-c3ccc(Cl)cc3)cn2)cc1 |
| InChI | InChI=1S/C29H29ClN2O2/c1-20(18-21(2)32-28(33)34-29(3,4)5)23-9-6-22(7-10-23)8-16-27-17-13-25(19-31-27)24-11-14-26(30)15-12-24/h6-7,9-15,17-19,21H,1-5H3,(H,32,33)/b20-18+/t21-/m0/s1 |
| InChIKey | WWKIEPWNWCXBCN-LSSWGTAKSA-N |
| XLogP | 7.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|