C22H46O2Si2 — CID 86602897
tert-butyl-[(4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyloct-7-ynoxy]-dimethylsilane (PubChem CID 86602897) has the molecular formula C22H46O2Si2 and a molecular weight of 398.78 g/mol. Its IUPAC name is tert-butyl-[(4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyloct-7-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyloct-7-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 86602897 |
| Molecular Formula | C22H46O2Si2 |
| Molecular Weight | 398.78 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | tert-butyl-[(4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyloct-7-ynoxy]-dimethylsilane |
| SMILES | C#C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O2Si2/c1-14-18(2)20(24-26(12,13)22(7,8)9)19(3)16-15-17-23-25(10,11)21(4,5)6/h1,18-20H,15-17H2,2-13H3/t18-,19-,20-/m0/s1 |
| InChIKey | AHESXNGICPESFS-UFYCRDLUSA-N |
| XLogP | 7.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.78 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|