C28H29FN2O — CID 86603049
N-[(4-tert-butylphenyl)methyl]-N-[2-(4-fluorophenyl)ethyl]-1H-indole-7-carboxamide (PubChem CID 86603049) has the molecular formula C28H29FN2O and a molecular weight of 428.55 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-N-[2-(4-fluorophenyl)ethyl]-1H-indole-7-carboxamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-N-[2-(4-fluorophenyl)ethyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 86603049 |
| Molecular Formula | C28H29FN2O |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-N-[2-(4-fluorophenyl)ethyl]-1H-indole-7-carboxamide |
| SMILES | CC(C)(C)c1ccc(CN(CCc2ccc(F)cc2)C(=O)c2cccc3cc[nH]c23)cc1 |
| InChI | InChI=1S/C28H29FN2O/c1-28(2,3)23-11-7-21(8-12-23)19-31(18-16-20-9-13-24(29)14-10-20)27(32)25-6-4-5-22-15-17-30-26(22)25/h4-15,17,30H,16,18-19H2,1-3H3 |
| InChIKey | ITDCSIITIGAKTP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |