C23H28N4O3 — CID 86603720
N-[6-[2-[[(3R)-1-phenylpyrrolidin-3-yl]amino]-3-pyridinyl]oxan-2-yl]oxyprop-2-enamide (PubChem CID 86603720) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[6-[2-[[(3R)-1-phenylpyrrolidin-3-yl]amino]-3-pyridinyl]oxan-2-yl]oxyprop-2-enamide.
| Compound Name | N-[6-[2-[[(3R)-1-phenylpyrrolidin-3-yl]amino]-3-pyridinyl]oxan-2-yl]oxyprop-2-enamide |
|---|---|
| PubChem CID | 86603720 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[6-[2-[[(3R)-1-phenylpyrrolidin-3-yl]amino]-3-pyridinyl]oxan-2-yl]oxyprop-2-enamide |
| SMILES | C=CC(=O)NOC1CCCC(c2cccnc2N[C@@H]2CCN(c3ccccc3)C2)O1 |
| InChI | InChI=1S/C23H28N4O3/c1-2-21(28)26-30-22-12-6-11-20(29-22)19-10-7-14-24-23(19)25-17-13-15-27(16-17)18-8-4-3-5-9-18/h2-5,7-10,14,17,20,22H,1,6,11-13,15-16H2,(H,24,25)(H,26,28)/t17-,20?,22?/m1/s1 |
| InChIKey | BOXAHEIBYQRCJQ-FEPNQTLGSA-N |
| XLogP | 3.57 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|