C34H43FN4O8S2 — CID 86603842
(E)-3-[5-fluoro-6-[[(3R)-1-oct-2-ynylpyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;bis(4-methylbenzenesulfonic acid) (PubChem CID 86603842) has the molecular formula C34H43FN4O8S2 and a molecular weight of 718.87 g/mol. Its IUPAC name is (E)-3-[5-fluoro-6-[[(3R)-1-oct-2-ynylpyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;bis(4-methylbenzenesulfonic acid).
| Compound Name | (E)-3-[5-fluoro-6-[[(3R)-1-oct-2-ynylpyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;bis(4-methylbenzenesulfonic acid) |
|---|---|
| PubChem CID | 86603842 |
| Molecular Formula | C34H43FN4O8S2 |
| Molecular Weight | 718.87 g/mol |
| Exact Mass | 718.25 |
| IUPAC Name | (E)-3-[5-fluoro-6-[[(3R)-1-oct-2-ynylpyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;bis(4-methylbenzenesulfonic acid) |
| SMILES | CCCCCC#CCN1CC[C@@H](Nc2ncc(/C=C/C(=O)NO)cc2F)C1.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H27FN4O2.2C7H8O3S/c1-2-3-4-5-6-7-11-25-12-10-17(15-25)23-20-18(21)13-16(14-22-20)8-9-19(26)24-27;2*1-6-2-4-7(5-3-6)11(8,9)10/h8-9,13-14,17,27H,2-5,10-12,15H2,1H3,(H,22,23)(H,24,26);2*2-5H,1H3,(H,8,9,10)/b9-8+;;/t17-;;/m1../s1 |
| InChIKey | GVSRABFMXNXKEI-UZQQGAHOSA-N |
| XLogP | 5.29 |
| TPSA | 186.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.87 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|