C17H24BrNO4 — CID 86604434
tert-butyl 4-(4-bromophenyl)-3-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 86604434) has the molecular formula C17H24BrNO4 and a molecular weight of 386.29 g/mol. Its IUPAC name is tert-butyl 4-(4-bromophenyl)-3-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-bromophenyl)-3-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86604434 |
| Molecular Formula | C17H24BrNO4 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | tert-butyl 4-(4-bromophenyl)-3-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)C(c2ccc(Br)cc2)C(CO)C1 |
| InChI | InChI=1S/C17H24BrNO4/c1-17(2,3)23-16(22)19-8-12(10-20)15(14(21)9-19)11-4-6-13(18)7-5-11/h4-7,12,14-15,20-21H,8-10H2,1-3H3 |
| InChIKey | PCHQQBURQDZEHI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |