C11H21IN3O3- — CID 86604508
tert-butyl 4-carbamimidoyl-3-hydroxypiperidine-1-carboxylate iodide (PubChem CID 86604508) has the molecular formula C11H21IN3O3- and a molecular weight of 370.21 g/mol. Its IUPAC name is tert-butyl 4-carbamimidoyl-3-hydroxypiperidine-1-carboxylate iodide.
| Compound Name | tert-butyl 4-carbamimidoyl-3-hydroxypiperidine-1-carboxylate iodide |
|---|---|
| PubChem CID | 86604508 |
| Molecular Formula | C11H21IN3O3- |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | tert-butyl 4-carbamimidoyl-3-hydroxypiperidine-1-carboxylate iodide |
| SMILES | [H]/N=C(\N)C1CCN(C(=O)OC(C)(C)C)CC1O.[I-] |
| InChI | InChI=1S/C11H21N3O3.HI/c1-11(2,3)17-10(16)14-5-4-7(9(12)13)8(15)6-14;/h7-8,15H,4-6H2,1-3H3,(H3,12,13);1H/p-1 |
| InChIKey | QKWMHUSFCDBXJF-UHFFFAOYSA-M |
| XLogP | -2.46 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|