About 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone
1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone (PubChem CID 86604710) has the molecular formula C20H14N4O9S
and a molecular weight of 486.42 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone.
Molecular Properties
| Compound Name | 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone |
| PubChem CID | 86604710 |
| Molecular Formula | C20H14N4O9S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.O=[N+]([O-])c1ccc(Sc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H6N4O8S.C8H8O/c17-13(18)7-1-3-11(9(5-7)15(21)22)25-12-4-2-8(14(19)20)6-10(12)16(23)24;1-7(9)8-5-3-2-4-6-8/h1-6H;2-6H,1H3 |
| InChIKey | GWQLLARPSUSFCI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 189.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone?
The IUPAC name of 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone (CID 86604710) is 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone.
What is the SMILES notation for 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone?
The canonical SMILES for 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone is CC(=O)c1ccccc1.O=[N+]([O-])c1ccc(Sc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1.
What is the InChIKey of 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone?
The InChIKey is GWQLLARPSUSFCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6N4O8S.C8H8O/c17-13(18)7-1-3-11(9(5-7)15(21)22)25-12-4-2-8(14(19)20)6-10(12)16(23)24;1-7(9)8-5-3-2-4-6-8/h1-6H;2-6H,1H3.
What are the key properties of 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone?
1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone has a molecular weight of 486.42 g/mol, XLogP of 5.36, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dinitrophenyl)sulfanyl-2,4-dinitrobenzene;1-phenylethanone is sourced from PubChem (CID 86604710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).