C17H15F2N5S — CID 86604831
2-(3-azidopropyl)-5-(2,5-difluorophenyl)-2-phenyl-3H-1,3,4-thiadiazole (PubChem CID 86604831) has the molecular formula C17H15F2N5S and a molecular weight of 359.41 g/mol. Its IUPAC name is 2-(3-azidopropyl)-5-(2,5-difluorophenyl)-2-phenyl-3H-1,3,4-thiadiazole.
| Compound Name | 2-(3-azidopropyl)-5-(2,5-difluorophenyl)-2-phenyl-3H-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 86604831 |
| Molecular Formula | C17H15F2N5S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-(3-azidopropyl)-5-(2,5-difluorophenyl)-2-phenyl-3H-1,3,4-thiadiazole |
| SMILES | [N-]=[N+]=NCCCC1(c2ccccc2)NN=C(c2cc(F)ccc2F)S1 |
| InChI | InChI=1S/C17H15F2N5S/c18-13-7-8-15(19)14(11-13)16-22-23-17(25-16,9-4-10-21-24-20)12-5-2-1-3-6-12/h1-3,5-8,11,23H,4,9-10H2 |
| InChIKey | VZMMECUJECPWTK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 73.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|