C21H24ClNO4S — CID 86604905
(3S,4aR,6S,8aR)-6-(3-carboxynaphthalen-2-yl)sulfanyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid;hydrochloride (PubChem CID 86604905) has the molecular formula C21H24ClNO4S and a molecular weight of 421.95 g/mol. Its IUPAC name is (3S,4aR,6S,8aR)-6-(3-carboxynaphthalen-2-yl)sulfanyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid;hydrochloride.
| Compound Name | (3S,4aR,6S,8aR)-6-(3-carboxynaphthalen-2-yl)sulfanyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 86604905 |
| Molecular Formula | C21H24ClNO4S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (3S,4aR,6S,8aR)-6-(3-carboxynaphthalen-2-yl)sulfanyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1cc2ccccc2cc1S[C@H]1CC[C@H]2CN[C@H](C(=O)O)C[C@@H]2C1 |
| InChI | InChI=1S/C21H23NO4S.ClH/c23-20(24)17-8-12-3-1-2-4-13(12)10-19(17)27-16-6-5-14-11-22-18(21(25)26)9-15(14)7-16;/h1-4,8,10,14-16,18,22H,5-7,9,11H2,(H,23,24)(H,25,26);1H/t14-,15-,16-,18-;/m0./s1 |
| InChIKey | FLRSTJFWFNYQQW-FQXFCSFRSA-N |
| XLogP | 4.28 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |