C23H17F3N4O2S — CID 86605135
2-cyanoethyl 6-(4-cyanophenyl)-4-methyl-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 86605135) has the molecular formula C23H17F3N4O2S and a molecular weight of 470.48 g/mol. Its IUPAC name is 2-cyanoethyl 6-(4-cyanophenyl)-4-methyl-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-cyanoethyl 6-(4-cyanophenyl)-4-methyl-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 86605135 |
| Molecular Formula | C23H17F3N4O2S |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 2-cyanoethyl 6-(4-cyanophenyl)-4-methyl-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OCCC#N)C(c2ccc(C#N)cc2)NC(=S)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H17F3N4O2S/c1-14-19(21(31)32-11-3-10-27)20(16-8-6-15(13-28)7-9-16)29-22(33)30(14)18-5-2-4-17(12-18)23(24,25)26/h2,4-9,12,20H,3,11H2,1H3,(H,29,33) |
| InChIKey | CZZBCLUNLATCMW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|