C28H30N2O3 — CID 86605206
9-methoxy-3-(3-methylphenyl)-2-phenylmethoxyimino-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-8-ol (PubChem CID 86605206) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 9-methoxy-3-(3-methylphenyl)-2-phenylmethoxyimino-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-8-ol.
| Compound Name | 9-methoxy-3-(3-methylphenyl)-2-phenylmethoxyimino-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-8-ol |
|---|---|
| PubChem CID | 86605206 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 9-methoxy-3-(3-methylphenyl)-2-phenylmethoxyimino-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-8-ol |
| SMILES | COc1ccc2c(c1O)CCN1CC(c3cccc(C)c3)C(=NOCc3ccccc3)CC21 |
| InChI | InChI=1S/C28H30N2O3/c1-19-7-6-10-21(15-19)24-17-30-14-13-23-22(11-12-27(32-2)28(23)31)26(30)16-25(24)29-33-18-20-8-4-3-5-9-20/h3-12,15,24,26,31H,13-14,16-18H2,1-2H3 |
| InChIKey | CWHPIJXTEOZORH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|