C18H23NO4 — CID 86605478
(4-methoxyimino-5,7,8-trimethylspiro[3H-chromene-2,1'-cyclobutane]-6-yl) acetate (PubChem CID 86605478) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is (4-methoxyimino-5,7,8-trimethylspiro[3H-chromene-2,1'-cyclobutane]-6-yl) acetate.
| Compound Name | (4-methoxyimino-5,7,8-trimethylspiro[3H-chromene-2,1'-cyclobutane]-6-yl) acetate |
|---|---|
| PubChem CID | 86605478 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (4-methoxyimino-5,7,8-trimethylspiro[3H-chromene-2,1'-cyclobutane]-6-yl) acetate |
| SMILES | CON=C1CC2(CCC2)Oc2c(C)c(C)c(OC(C)=O)c(C)c21 |
| InChI | InChI=1S/C18H23NO4/c1-10-11(2)17-15(12(3)16(10)22-13(4)20)14(19-21-5)9-18(23-17)7-6-8-18/h6-9H2,1-5H3 |
| InChIKey | ZNRLEYRJVHONHU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|