About iron;(Z)-octadec-9-enoate
iron;(Z)-octadec-9-enoate (PubChem CID 86605544) has the molecular formula C18H33FeO2-
and a molecular weight of 337.31 g/mol. Its IUPAC name is iron;(Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | iron;(Z)-octadec-9-enoate |
| PubChem CID | 86605544 |
| Molecular Formula | C18H33FeO2- |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | iron;(Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)[O-].[Fe] |
| InChI | InChI=1S/C18H34O2.Fe/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h9-10H,2-8,11-17H2,1H3,(H,19,20);/p-1/b10-9-; |
| InChIKey | DEVYBOZJYUYBMC-KVVVOXFISA-M |
| XLogP | 4.77 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze iron;(Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;(Z)-octadec-9-enoate?
The IUPAC name of iron;(Z)-octadec-9-enoate (CID 86605544) is iron;(Z)-octadec-9-enoate.
What is the SMILES notation for iron;(Z)-octadec-9-enoate?
The canonical SMILES for iron;(Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)[O-].[Fe].
What is the InChIKey of iron;(Z)-octadec-9-enoate?
The InChIKey is DEVYBOZJYUYBMC-KVVVOXFISA-M. The full InChI is InChI=1S/C18H34O2.Fe/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h9-10H,2-8,11-17H2,1H3,(H,19,20);/p-1/b10-9-;.
What are the key properties of iron;(Z)-octadec-9-enoate?
iron;(Z)-octadec-9-enoate has a molecular weight of 337.31 g/mol, XLogP of 4.77, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iron;(Z)-octadec-9-enoate is sourced from PubChem (CID 86605544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).