C27H34F4O4S2 — CID 86605945
2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate;1-(6-butoxynaphthalen-2-yl)thiolan-1-ium (PubChem CID 86605945) has the molecular formula C27H34F4O4S2 and a molecular weight of 562.69 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate;1-(6-butoxynaphthalen-2-yl)thiolan-1-ium.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate;1-(6-butoxynaphthalen-2-yl)thiolan-1-ium |
|---|---|
| PubChem CID | 86605945 |
| Molecular Formula | C27H34F4O4S2 |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate;1-(6-butoxynaphthalen-2-yl)thiolan-1-ium |
| SMILES | CCCCOc1ccc2cc([S+]3CCCC3)ccc2c1.O=S(=O)([O-])C(F)(F)C(F)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C18H23OS.C9H12F4O3S/c1-2-3-10-19-17-8-6-16-14-18(9-7-15(16)13-17)20-11-4-5-12-20;10-8(11,9(12,13)17(14,15)16)7-4-5-1-2-6(7)3-5/h6-9,13-14H,2-5,10-12H2,1H3;5-7H,1-4H2,(H,14,15,16)/q+1;/p-1 |
| InChIKey | COAPLGOCHZYBCI-UHFFFAOYSA-M |
| XLogP | 6.99 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|