C22H24O7 — CID 86605981
(2R,3R,4S,5S,6R)-2-[5-[(4-ethynylphenyl)methyl]-2-methoxyphenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 86605981) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-[(4-ethynylphenyl)methyl]-2-methoxyphenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-[(4-ethynylphenyl)methyl]-2-methoxyphenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 86605981 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-[(4-ethynylphenyl)methyl]-2-methoxyphenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | C#Cc1ccc(Cc2ccc(OC)c([C@@]3(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1 |
| InChI | InChI=1S/C22H24O7/c1-3-13-4-6-14(7-5-13)10-15-8-9-17(28-2)16(11-15)22(27)21(26)20(25)19(24)18(12-23)29-22/h1,4-9,11,18-21,23-27H,10,12H2,2H3/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | AHPHBMNKCIWEBW-QMCAAQAGSA-N |
| XLogP | -0.11 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|