C17H23NO3 — CID 86606484
cis-(3S,5R)-3,5-dimethyl-1-(phenylmethoxyiminomethyl)cyclohexane-1-carboxylic acid (PubChem CID 86606484) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is cis-(3S,5R)-3,5-dimethyl-1-(phenylmethoxyiminomethyl)cyclohexane-1-carboxylic acid.
| Compound Name | cis-(3S,5R)-3,5-dimethyl-1-(phenylmethoxyiminomethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 86606484 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | cis-(3S,5R)-3,5-dimethyl-1-(phenylmethoxyiminomethyl)cyclohexane-1-carboxylic acid |
| SMILES | C[C@@H]1C[C@H](C)CC(C=NOCc2ccccc2)(C(=O)O)C1 |
| InChI | InChI=1S/C17H23NO3/c1-13-8-14(2)10-17(9-13,16(19)20)12-18-21-11-15-6-4-3-5-7-15/h3-7,12-14H,8-11H2,1-2H3,(H,19,20)/t13-,14+,17? |
| InChIKey | ZQFXJLLLFWGWNE-VMZNBEPHSA-N |
| XLogP | 3.72 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|