About 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid (PubChem CID 86606531) has the molecular formula C18H10ClF6N3O2
and a molecular weight of 449.74 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid |
| PubChem CID | 86606531 |
| Molecular Formula | C18H10ClF6N3O2 |
| Molecular Weight | 449.74 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1-c1ccccc1Cl |
| InChI | InChI=1S/C18H10ClF6N3O2/c19-13-4-2-1-3-12(13)15-14(16(29)30)26-27-28(15)8-9-5-10(17(20,21)22)7-11(6-9)18(23,24)25/h1-7H,8H2,(H,29,30) |
| InChIKey | SZLBCWPIBONWHT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.74 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid?
The IUPAC name of 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid (CID 86606531) is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid.
What is the SMILES notation for 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid?
The canonical SMILES for 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid is O=C(O)c1nnn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1-c1ccccc1Cl.
What is the InChIKey of 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid?
The InChIKey is SZLBCWPIBONWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10ClF6N3O2/c19-13-4-2-1-3-12(13)15-14(16(29)30)26-27-28(15)8-9-5-10(17(20,21)22)7-11(6-9)18(23,24)25/h1-7H,8H2,(H,29,30).
What are the key properties of 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid?
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid has a molecular weight of 449.74 g/mol, XLogP of 5.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-chlorophenyl)triazole-4-carboxylic acid is sourced from PubChem (CID 86606531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).