About methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate
methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate (PubChem CID 86606538) has the molecular formula C13H10F6N4O2
and a molecular weight of 368.24 g/mol. Its IUPAC name is methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate |
| PubChem CID | 86606538 |
| Molecular Formula | C13H10F6N4O2 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1N |
| InChI | InChI=1S/C13H10F6N4O2/c1-25-11(24)9-10(20)23(22-21-9)5-6-2-7(12(14,15)16)4-8(3-6)13(17,18)19/h2-4H,5,20H2,1H3 |
| InChIKey | GACIGWCMNPFAJQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate?
The IUPAC name of methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate (CID 86606538) is methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate.
What is the SMILES notation for methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate?
The canonical SMILES for methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate is COC(=O)c1nnn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1N.
What is the InChIKey of methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate?
The InChIKey is GACIGWCMNPFAJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F6N4O2/c1-25-11(24)9-10(20)23(22-21-9)5-6-2-7(12(14,15)16)4-8(3-6)13(17,18)19/h2-4H,5,20H2,1H3.
What are the key properties of methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate?
methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate has a molecular weight of 368.24 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]triazole-4-carboxylate is sourced from PubChem (CID 86606538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).