C23H22F8O5S — CID 86606915
[(2R,3R,4R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(3,4-difluorophenyl)oxan-4-yl]methyl methanesulfonate (PubChem CID 86606915) has the molecular formula C23H22F8O5S and a molecular weight of 562.48 g/mol. Its IUPAC name is [(2R,3R,4R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(3,4-difluorophenyl)oxan-4-yl]methyl methanesulfonate.
| Compound Name | [(2R,3R,4R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(3,4-difluorophenyl)oxan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 86606915 |
| Molecular Formula | C23H22F8O5S |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | [(2R,3R,4R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(3,4-difluorophenyl)oxan-4-yl]methyl methanesulfonate |
| SMILES | C[C@@H](O[C@H]1OCC[C@@H](COS(C)(=O)=O)C1c1ccc(F)c(F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F8O5S/c1-12(15-7-16(22(26,27)28)10-17(8-15)23(29,30)31)36-21-20(13-3-4-18(24)19(25)9-13)14(5-6-34-21)11-35-37(2,32)33/h3-4,7-10,12,14,20-21H,5-6,11H2,1-2H3/t12-,14+,20?,21-/m1/s1 |
| InChIKey | CJBOFMPLGPQDIP-LKQFNGLTSA-N |
| XLogP | 6.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|