C26H28F6O3 — CID 86606916
1-[(2R,3R,4R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]pent-4-en-1-ol (PubChem CID 86606916) has the molecular formula C26H28F6O3 and a molecular weight of 502.50 g/mol. Its IUPAC name is 1-[(2R,3R,4R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]pent-4-en-1-ol.
| Compound Name | 1-[(2R,3R,4R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]pent-4-en-1-ol |
|---|---|
| PubChem CID | 86606916 |
| Molecular Formula | C26H28F6O3 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 1-[(2R,3R,4R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]pent-4-en-1-ol |
| SMILES | C=CCCC(O)[C@@H]1CCO[C@H](O[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1 |
| InChI | InChI=1S/C26H28F6O3/c1-3-4-10-22(33)21-11-12-34-24(23(21)17-8-6-5-7-9-17)35-16(2)18-13-19(25(27,28)29)15-20(14-18)26(30,31)32/h3,5-9,13-16,21-24,33H,1,4,10-12H2,2H3/t16-,21+,22?,23?,24-/m1/s1 |
| InChIKey | IHOJRALYPHHOBP-CXCCALLUSA-N |
| XLogP | 7.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|