C25H26F6O3 — CID 86606917
(1R)-1-[(2R,3R,4R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]but-3-en-1-ol (PubChem CID 86606917) has the molecular formula C25H26F6O3 and a molecular weight of 488.47 g/mol. Its IUPAC name is (1R)-1-[(2R,3R,4R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]but-3-en-1-ol.
| Compound Name | (1R)-1-[(2R,3R,4R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 86606917 |
| Molecular Formula | C25H26F6O3 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (1R)-1-[(2R,3R,4R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]but-3-en-1-ol |
| SMILES | C=CC[C@@H](O)[C@@H]1CCO[C@H](O[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1 |
| InChI | InChI=1S/C25H26F6O3/c1-3-7-21(32)20-10-11-33-23(22(20)16-8-5-4-6-9-16)34-15(2)17-12-18(24(26,27)28)14-19(13-17)25(29,30)31/h3-6,8-9,12-15,20-23,32H,1,7,10-11H2,2H3/t15-,20+,21-,22?,23-/m1/s1 |
| InChIKey | TVJVLRIQCPYKPJ-MRWJHVEQSA-N |
| XLogP | 6.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|