C22H18N4O3S — CID 86607546
methyl 2-[8-(5-formylthiophen-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]pyrimidine-5-carboxylate (PubChem CID 86607546) has the molecular formula C22H18N4O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is methyl 2-[8-(5-formylthiophen-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]pyrimidine-5-carboxylate.
| Compound Name | methyl 2-[8-(5-formylthiophen-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 86607546 |
| Molecular Formula | C22H18N4O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | methyl 2-[8-(5-formylthiophen-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(N2CCc3[nH]c4ccc(-c5ccc(C=O)s5)cc4c3C2)nc1 |
| InChI | InChI=1S/C22H18N4O3S/c1-29-21(28)14-9-23-22(24-10-14)26-7-6-19-17(11-26)16-8-13(2-4-18(16)25-19)20-5-3-15(12-27)30-20/h2-5,8-10,12,25H,6-7,11H2,1H3 |
| InChIKey | CRPTZFCRMLKMRX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|