C20H16FN5O — CID 86607585
3-(3-cyanoanilino)-N-(5-fluoro-6-methyl-2-pyridinyl)-6-methylpyridine-2-carboxamide (PubChem CID 86607585) has the molecular formula C20H16FN5O and a molecular weight of 361.38 g/mol. Its IUPAC name is 3-(3-cyanoanilino)-N-(5-fluoro-6-methyl-2-pyridinyl)-6-methylpyridine-2-carboxamide.
| Compound Name | 3-(3-cyanoanilino)-N-(5-fluoro-6-methyl-2-pyridinyl)-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 86607585 |
| Molecular Formula | C20H16FN5O |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-(3-cyanoanilino)-N-(5-fluoro-6-methyl-2-pyridinyl)-6-methylpyridine-2-carboxamide |
| SMILES | Cc1ccc(Nc2cccc(C#N)c2)c(C(=O)Nc2ccc(F)c(C)n2)n1 |
| InChI | InChI=1S/C20H16FN5O/c1-12-6-8-17(25-15-5-3-4-14(10-15)11-22)19(23-12)20(27)26-18-9-7-16(21)13(2)24-18/h3-10,25H,1-2H3,(H,24,26,27) |
| InChIKey | IUHSWQFQEVZFQQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |