C21H9F7N4 — CID 86608076
3-[2-(6-fluoro-3-pyridinyl)ethynyl]-7-(trifluoromethyl)-5-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine (PubChem CID 86608076) has the molecular formula C21H9F7N4 and a molecular weight of 450.32 g/mol. Its IUPAC name is 3-[2-(6-fluoro-3-pyridinyl)ethynyl]-7-(trifluoromethyl)-5-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine.
| Compound Name | 3-[2-(6-fluoro-3-pyridinyl)ethynyl]-7-(trifluoromethyl)-5-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 86608076 |
| Molecular Formula | C21H9F7N4 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 3-[2-(6-fluoro-3-pyridinyl)ethynyl]-7-(trifluoromethyl)-5-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidine |
| SMILES | Fc1ccc(C#Cc2cnn3c(C(F)(F)F)cc(-c4ccc(C(F)(F)F)cc4)nc23)cn1 |
| InChI | InChI=1S/C21H9F7N4/c22-18-8-2-12(10-29-18)1-3-14-11-30-32-17(21(26,27)28)9-16(31-19(14)32)13-4-6-15(7-5-13)20(23,24)25/h2,4-11H |
| InChIKey | MEPAECMPLGCISQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|