C16H10ClF2N3 — CID 86608084
5-(4-chloro-3-methylphenyl)-7-(difluoromethyl)-3-ethynylpyrazolo[1,5-a]pyrimidine (PubChem CID 86608084) has the molecular formula C16H10ClF2N3 and a molecular weight of 317.73 g/mol. Its IUPAC name is 5-(4-chloro-3-methylphenyl)-7-(difluoromethyl)-3-ethynylpyrazolo[1,5-a]pyrimidine.
| Compound Name | 5-(4-chloro-3-methylphenyl)-7-(difluoromethyl)-3-ethynylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 86608084 |
| Molecular Formula | C16H10ClF2N3 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 5-(4-chloro-3-methylphenyl)-7-(difluoromethyl)-3-ethynylpyrazolo[1,5-a]pyrimidine |
| SMILES | C#Cc1cnn2c(C(F)F)cc(-c3ccc(Cl)c(C)c3)nc12 |
| InChI | InChI=1S/C16H10ClF2N3/c1-3-10-8-20-22-14(15(18)19)7-13(21-16(10)22)11-4-5-12(17)9(2)6-11/h1,4-8,15H,2H3 |
| InChIKey | HFISPKPWMMJYSP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|