C7H10N4O2S — CID 86610341
3-[3-(carbamothioylamino)pyrazol-1-yl]propanoic acid (PubChem CID 86610341) has the molecular formula C7H10N4O2S and a molecular weight of 214.25 g/mol. Its IUPAC name is 3-[3-(carbamothioylamino)pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[3-(carbamothioylamino)pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 86610341 |
| Molecular Formula | C7H10N4O2S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 3-[3-(carbamothioylamino)pyrazol-1-yl]propanoic acid |
| SMILES | NC(=S)Nc1ccn(CCC(=O)O)n1 |
| InChI | InChI=1S/C7H10N4O2S/c8-7(14)9-5-1-3-11(10-5)4-2-6(12)13/h1,3H,2,4H2,(H,12,13)(H3,8,9,10,14) |
| InChIKey | KTYPNYUMIGNGOG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|