About 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate
4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate (PubChem CID 86610495) has the molecular formula C9H7NO6-2
and a molecular weight of 225.16 g/mol. Its IUPAC name is 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate |
| PubChem CID | 86610495 |
| Molecular Formula | C9H7NO6-2 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate |
| SMILES | CC1(C(=O)[O-])C=CC(C(=O)[O-])=CC1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9NO6/c1-9(8(13)14)3-2-5(7(11)12)4-6(9)10(15)16/h2-4,6H,1H3,(H,11,12)(H,13,14)/p-2 |
| InChIKey | XYIPSNDOMJXBBC-UHFFFAOYSA-L |
| XLogP | -2.37 |
| TPSA | 123.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate?
The IUPAC name of 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate (CID 86610495) is 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate.
What is the SMILES notation for 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate?
The canonical SMILES for 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate is CC1(C(=O)[O-])C=CC(C(=O)[O-])=CC1[N+](=O)[O-].
What is the InChIKey of 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate?
The InChIKey is XYIPSNDOMJXBBC-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H9NO6/c1-9(8(13)14)3-2-5(7(11)12)4-6(9)10(15)16/h2-4,6H,1H3,(H,11,12)(H,13,14)/p-2.
What are the key properties of 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate?
4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate has a molecular weight of 225.16 g/mol, XLogP of -2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-nitrocyclohexa-1,5-diene-1,4-dicarboxylate is sourced from PubChem (CID 86610495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).