C28H29F6N5O4 — CID 86610583
ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(hydroxymethyl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 86610583) has the molecular formula C28H29F6N5O4 and a molecular weight of 613.56 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(hydroxymethyl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(hydroxymethyl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 86610583 |
| Molecular Formula | C28H29F6N5O4 |
| Molecular Weight | 613.56 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(hydroxymethyl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](Nc2ncc(CO)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C[C@H]1CC |
| InChI | InChI=1S/C28H29F6N5O4/c1-4-19-12-21(24-22(6-7-23(38-24)42-3)39(19)26(41)43-5-2)37-25-35-13-16(14-40)20(36-25)10-15-8-17(27(29,30)31)11-18(9-15)28(32,33)34/h6-9,11,13,19,21,40H,4-5,10,12,14H2,1-3H3,(H,35,36,37)/t19-,21+/m1/s1 |
| InChIKey | DIUXGUAQHRJQMM-CTNGQTDRSA-N |
| XLogP | 6.30 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |