C29H31F6N5O4 — CID 86610584
ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(methoxymethyl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 86610584) has the molecular formula C29H31F6N5O4 and a molecular weight of 627.59 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(methoxymethyl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(methoxymethyl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 86610584 |
| Molecular Formula | C29H31F6N5O4 |
| Molecular Weight | 627.59 g/mol |
| Exact Mass | 627.23 |
| IUPAC Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(methoxymethyl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](Nc2ncc(COC)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C[C@H]1CC |
| InChI | InChI=1S/C29H31F6N5O4/c1-5-20-13-22(25-23(7-8-24(39-25)43-4)40(20)27(41)44-6-2)38-26-36-14-17(15-42-3)21(37-26)11-16-9-18(28(30,31)32)12-19(10-16)29(33,34)35/h7-10,12,14,20,22H,5-6,11,13,15H2,1-4H3,(H,36,37,38)/t20-,22+/m1/s1 |
| InChIKey | XTJZPCHHPIHTOR-IRLDBZIGSA-N |
| XLogP | 6.95 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.59 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |