C33H30F6N6O4 — CID 86610596
ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(5-formyl-3-pyridinyl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 86610596) has the molecular formula C33H30F6N6O4 and a molecular weight of 688.63 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(5-formyl-3-pyridinyl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(5-formyl-3-pyridinyl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 86610596 |
| Molecular Formula | C33H30F6N6O4 |
| Molecular Weight | 688.63 g/mol |
| Exact Mass | 688.22 |
| IUPAC Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(5-formyl-3-pyridinyl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](Nc2ncc(-c3cncc(C=O)c3)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C[C@H]1CC |
| InChI | InChI=1S/C33H30F6N6O4/c1-4-23-13-26(29-27(6-7-28(44-29)48-3)45(23)31(47)49-5-2)43-30-41-16-24(20-8-19(17-46)14-40-15-20)25(42-30)11-18-9-21(32(34,35)36)12-22(10-18)33(37,38)39/h6-10,12,14-17,23,26H,4-5,11,13H2,1-3H3,(H,41,42,43)/t23-,26+/m1/s1 |
| InChIKey | WMPSWJAUSNWZOK-BVAGGSTKSA-N |
| XLogP | 7.68 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.63 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|