C31H35F6N7O3 — CID 86610604
ethyl (2R,4S)-6-(aminomethyl)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-ylpyrimidin-2-yl]amino]-2-ethyl-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 86610604) has the molecular formula C31H35F6N7O3 and a molecular weight of 667.66 g/mol. Its IUPAC name is ethyl (2R,4S)-6-(aminomethyl)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-ylpyrimidin-2-yl]amino]-2-ethyl-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-6-(aminomethyl)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-ylpyrimidin-2-yl]amino]-2-ethyl-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 86610604 |
| Molecular Formula | C31H35F6N7O3 |
| Molecular Weight | 667.66 g/mol |
| Exact Mass | 667.27 |
| IUPAC Name | ethyl (2R,4S)-6-(aminomethyl)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-ylpyrimidin-2-yl]amino]-2-ethyl-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(CN)nc2[C@@H](Nc2ncc(N3CCOCC3)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C[C@H]1CC |
| InChI | InChI=1S/C31H35F6N7O3/c1-3-22-15-24(27-25(6-5-21(16-38)40-27)44(22)29(45)47-4-2)42-28-39-17-26(43-7-9-46-10-8-43)23(41-28)13-18-11-19(30(32,33)34)14-20(12-18)31(35,36)37/h5-6,11-12,14,17,22,24H,3-4,7-10,13,15-16,38H2,1-2H3,(H,39,41,42)/t22-,24+/m1/s1 |
| InChIKey | DJJVDHGCGBIOOU-VWNXMTODSA-N |
| XLogP | 6.09 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |