C31H34F6N6O3 — CID 86610605
ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-ylpyrimidin-2-yl]amino]-2-ethyl-6-methyl-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 86610605) has the molecular formula C31H34F6N6O3 and a molecular weight of 652.64 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-ylpyrimidin-2-yl]amino]-2-ethyl-6-methyl-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-ylpyrimidin-2-yl]amino]-2-ethyl-6-methyl-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 86610605 |
| Molecular Formula | C31H34F6N6O3 |
| Molecular Weight | 652.64 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-ylpyrimidin-2-yl]amino]-2-ethyl-6-methyl-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(C)nc2[C@@H](Nc2ncc(N3CCOCC3)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C[C@H]1CC |
| InChI | InChI=1S/C31H34F6N6O3/c1-4-22-16-24(27-25(7-6-18(3)39-27)43(22)29(44)46-5-2)41-28-38-17-26(42-8-10-45-11-9-42)23(40-28)14-19-12-20(30(32,33)34)15-21(13-19)31(35,36)37/h6-7,12-13,15,17,22,24H,4-5,8-11,14,16H2,1-3H3,(H,38,40,41)/t22-,24+/m1/s1 |
| InChIKey | PJXRPRLWRJSMSA-VWNXMTODSA-N |
| XLogP | 6.94 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.64 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |