C31H33F6N5O4 — CID 86610609
ethyl (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(C-ethoxycarbonimidoyl)-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 86610609) has the molecular formula C31H33F6N5O4 and a molecular weight of 653.62 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(C-ethoxycarbonimidoyl)-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(C-ethoxycarbonimidoyl)-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 86610609 |
| Molecular Formula | C31H33F6N5O4 |
| Molecular Weight | 653.62 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | ethyl (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(C-ethoxycarbonimidoyl)-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | [H]/N=C(\OCC)c1cnc(N[C@H]2C[C@@H](CC)N(C(=O)OCC)c3ccc(OC)nc32)c(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C31H33F6N5O4/c1-5-22-15-23(26-24(8-9-25(41-26)44-4)42(22)29(43)46-7-3)40-28-18(13-19(16-39-28)27(38)45-6-2)10-17-11-20(30(32,33)34)14-21(12-17)31(35,36)37/h8-9,11-14,16,22-23,38H,5-7,10,15H2,1-4H3,(H,39,40)/b38-27-/t22-,23+/m1/s1 |
| InChIKey | QAYSNSUTEVVBIU-RAKTYSAVSA-N |
| XLogP | 7.77 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.62 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|