C29H30F6N6O4 — CID 86610691
ethyl (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(N'-hydroxycarbamimidoyl)-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 86610691) has the molecular formula C29H30F6N6O4 and a molecular weight of 640.59 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(N'-hydroxycarbamimidoyl)-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(N'-hydroxycarbamimidoyl)-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 86610691 |
| Molecular Formula | C29H30F6N6O4 |
| Molecular Weight | 640.59 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | ethyl (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(N'-hydroxycarbamimidoyl)-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](Nc2ncc(C(N)=NO)cc2Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C[C@H]1CC |
| InChI | InChI=1S/C29H30F6N6O4/c1-4-20-13-21(24-22(6-7-23(39-24)44-3)41(20)27(42)45-5-2)38-26-16(11-17(14-37-26)25(36)40-43)8-15-9-18(28(30,31)32)12-19(10-15)29(33,34)35/h6-7,9-12,14,20-21,43H,4-5,8,13H2,1-3H3,(H2,36,40)(H,37,38)/t20-,21+/m1/s1 |
| InChIKey | ALOPJOPOMQYWNP-RTWAWAEBSA-N |
| XLogP | 6.51 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|