C32H35F6N5O4 — CID 86610694
ethyl (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 86610694) has the molecular formula C32H35F6N5O4 and a molecular weight of 667.65 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 86610694 |
| Molecular Formula | C32H35F6N5O4 |
| Molecular Weight | 667.65 g/mol |
| Exact Mass | 667.26 |
| IUPAC Name | ethyl (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](Nc2ncc(N3CCOCC3)cc2Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C[C@H]1CC |
| InChI | InChI=1S/C32H35F6N5O4/c1-4-23-17-25(28-26(6-7-27(41-28)45-3)43(23)30(44)47-5-2)40-29-20(15-24(18-39-29)42-8-10-46-11-9-42)12-19-13-21(31(33,34)35)16-22(14-19)32(36,37)38/h6-7,13-16,18,23,25H,4-5,8-12,17H2,1-3H3,(H,39,40)/t23-,25+/m1/s1 |
| InChIKey | FCWAHYZZGPANEM-NOZRDPDXSA-N |
| XLogP | 7.25 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.65 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |