About 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine
5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine (PubChem CID 86611053) has the molecular formula C15H15IN4O
and a molecular weight of 394.22 g/mol. Its IUPAC name is 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine |
| PubChem CID | 86611053 |
| Molecular Formula | C15H15IN4O |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine |
| SMILES | C=CC=Cc1cc(Oc2cnc(N)nc2N)c(I)cc1C |
| InChI | InChI=1S/C15H15IN4O/c1-3-4-5-10-7-12(11(16)6-9(10)2)21-13-8-19-15(18)20-14(13)17/h3-8H,1H2,2H3,(H4,17,18,19,20) |
| InChIKey | XOIUYSRKUGTSNI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine?
The IUPAC name of 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine (CID 86611053) is 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine.
What is the SMILES notation for 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine?
The canonical SMILES for 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine is C=CC=Cc1cc(Oc2cnc(N)nc2N)c(I)cc1C.
What is the InChIKey of 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine?
The InChIKey is XOIUYSRKUGTSNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15IN4O/c1-3-4-5-10-7-12(11(16)6-9(10)2)21-13-8-19-15(18)20-14(13)17/h3-8H,1H2,2H3,(H4,17,18,19,20).
What are the key properties of 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine?
5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine has a molecular weight of 394.22 g/mol, XLogP of 3.55, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-buta-1,3-dienyl-2-iodo-4-methylphenoxy)pyrimidine-2,4-diamine is sourced from PubChem (CID 86611053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).