C22H25NO2 — CID 86611062
ethyl (4aR,9bS)-6-methyl-8-phenyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridine-2-carboxylate (PubChem CID 86611062) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is ethyl (4aR,9bS)-6-methyl-8-phenyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridine-2-carboxylate.
| Compound Name | ethyl (4aR,9bS)-6-methyl-8-phenyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 86611062 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | ethyl (4aR,9bS)-6-methyl-8-phenyl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)N1CC[C@H]2Cc3c(C)cc(-c4ccccc4)cc3[C@H]2C1 |
| InChI | InChI=1S/C22H25NO2/c1-3-25-22(24)23-10-9-17-12-19-15(2)11-18(13-20(19)21(17)14-23)16-7-5-4-6-8-16/h4-8,11,13,17,21H,3,9-10,12,14H2,1-2H3/t17-,21-/m0/s1 |
| InChIKey | VOYWHNYAYIDKDG-UWJYYQICSA-N |
| XLogP | 4.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |