C18H28N4O4S2 — CID 86611181
1,1-dicyclohexyl-3-[4-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-1,3-thiazol-2-yl]urea (PubChem CID 86611181) has the molecular formula C18H28N4O4S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1,1-dicyclohexyl-3-[4-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1,1-dicyclohexyl-3-[4-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 86611181 |
| Molecular Formula | C18H28N4O4S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 1,1-dicyclohexyl-3-[4-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-1,3-thiazol-2-yl]urea |
| SMILES | CS(=O)(=O)C(=NO)c1csc(NC(=O)N(C2CCCCC2)C2CCCCC2)n1 |
| InChI | InChI=1S/C18H28N4O4S2/c1-28(25,26)16(21-24)15-12-27-17(19-15)20-18(23)22(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h12-14,24H,2-11H2,1H3,(H,19,20,23) |
| InChIKey | JXKFWKJGXOXTSS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|