About pent-4-enyl benzenesulfonate
pent-4-enyl benzenesulfonate (PubChem CID 86611585) has the molecular formula C11H14O3S
and a molecular weight of 226.30 g/mol. Its IUPAC name is pent-4-enyl benzenesulfonate.
Molecular Properties
| Compound Name | pent-4-enyl benzenesulfonate |
| PubChem CID | 86611585 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | pent-4-enyl benzenesulfonate |
| SMILES | C=CCCCOS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O3S/c1-2-3-7-10-14-15(12,13)11-8-5-4-6-9-11/h2,4-6,8-9H,1,3,7,10H2 |
| InChIKey | NUMOFHXGUDJVLY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze pent-4-enyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-enyl benzenesulfonate?
The IUPAC name of pent-4-enyl benzenesulfonate (CID 86611585) is pent-4-enyl benzenesulfonate.
What is the SMILES notation for pent-4-enyl benzenesulfonate?
The canonical SMILES for pent-4-enyl benzenesulfonate is C=CCCCOS(=O)(=O)c1ccccc1.
What is the InChIKey of pent-4-enyl benzenesulfonate?
The InChIKey is NUMOFHXGUDJVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3S/c1-2-3-7-10-14-15(12,13)11-8-5-4-6-9-11/h2,4-6,8-9H,1,3,7,10H2.
What are the key properties of pent-4-enyl benzenesulfonate?
pent-4-enyl benzenesulfonate has a molecular weight of 226.30 g/mol, XLogP of 2.36, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-enyl benzenesulfonate is sourced from PubChem (CID 86611585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).