About 8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine
8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine (PubChem CID 86611746) has the molecular formula C8H7BrClN3
and a molecular weight of 260.52 g/mol. Its IUPAC name is 8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine.
Analyze 8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine?
The IUPAC name of 8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine (CID 86611746) is 8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine.
What is the SMILES notation for 8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine?
The canonical SMILES for 8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine is Cc1nc2c(Br)cc(Cl)nn2c1C.
What is the InChIKey of 8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine?
The InChIKey is UBAJZBLYEMGSFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrClN3/c1-4-5(2)13-8(11-4)6(9)3-7(10)12-13/h3H,1-2H3.
What are the key properties of 8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine?
8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine has a molecular weight of 260.52 g/mol, XLogP of 2.76, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-6-chloro-2,3-dimethylimidazo[1,2-b]pyridazine is sourced from PubChem (CID 86611746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).